C20H16FN3O5S — CID 40927804
ethyl 2-[6-fluoro-2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 40927804) has the molecular formula C20H16FN3O5S and a molecular weight of 429.43 g/mol. Its IUPAC name is ethyl 2-[6-fluoro-2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-fluoro-2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 40927804 |
| Molecular Formula | C20H16FN3O5S |
| Molecular Weight | 429.43 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | ethyl 2-[6-fluoro-2-[(E)-3-(3-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)/C=C/c2cccc([N+](=O)[O-])c2)sc2cc(F)ccc21 |
| InChI | InChI=1S/C20H16FN3O5S/c1-2-29-19(26)12-23-16-8-7-14(21)11-17(16)30-20(23)22-18(25)9-6-13-4-3-5-15(10-13)24(27)28/h3-11H,2,12H2,1H3/b9-6+,22-20- |
| InChIKey | YSXRRWFVKKAFQE-TZEZGEGSSA-N |
| XLogP | 3.45 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|