C20H15F2N3O5S — CID 40927875
ethyl 2-[4,6-difluoro-2-[(E)-3-(4-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 40927875) has the molecular formula C20H15F2N3O5S and a molecular weight of 447.42 g/mol. Its IUPAC name is ethyl 2-[4,6-difluoro-2-[(E)-3-(4-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[4,6-difluoro-2-[(E)-3-(4-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 40927875 |
| Molecular Formula | C20H15F2N3O5S |
| Molecular Weight | 447.42 g/mol |
| Exact Mass | 447.07 |
| IUPAC Name | ethyl 2-[4,6-difluoro-2-[(E)-3-(4-nitrophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)/C=C/c2ccc([N+](=O)[O-])cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C20H15F2N3O5S/c1-2-30-18(27)11-24-19-15(22)9-13(21)10-16(19)31-20(24)23-17(26)8-5-12-3-6-14(7-4-12)25(28)29/h3-10H,2,11H2,1H3/b8-5+,23-20- |
| InChIKey | VWYDVJXMGRMNJJ-OCULNYMISA-N |
| XLogP | 3.59 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|