C16H11F2N3O3S2 — CID 40885674
(E)-N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide (PubChem CID 40885674) has the molecular formula C16H11F2N3O3S2 and a molecular weight of 395.41 g/mol. Its IUPAC name is (E)-N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide.
| Compound Name | (E)-N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
|---|---|
| PubChem CID | 40885674 |
| Molecular Formula | C16H11F2N3O3S2 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | (E)-N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-(5-nitrothiophen-2-yl)prop-2-enamide |
| SMILES | CCn1/c(=N/C(=O)/C=C/c2ccc([N+](=O)[O-])s2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C16H11F2N3O3S2/c1-2-20-15-11(18)7-9(17)8-12(15)26-16(20)19-13(22)5-3-10-4-6-14(25-10)21(23)24/h3-8H,2H2,1H3/b5-3+,19-16- |
| InChIKey | RSPFGBCKRVOPCR-MYMQXPBGSA-N |
| XLogP | 4.11 |
| TPSA | 77.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|