C18H14F2N2OS — CID 40885581
(E)-N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide (PubChem CID 40885581) has the molecular formula C18H14F2N2OS and a molecular weight of 344.39 g/mol. Its IUPAC name is (E)-N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide.
| Compound Name | (E)-N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 40885581 |
| Molecular Formula | C18H14F2N2OS |
| Molecular Weight | 344.39 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (E)-N-(3-ethyl-4,6-difluoro-1,3-benzothiazol-2-ylidene)-3-phenylprop-2-enamide |
| SMILES | CCn1/c(=N/C(=O)/C=C/c2ccccc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C18H14F2N2OS/c1-2-22-17-14(20)10-13(19)11-15(17)24-18(22)21-16(23)9-8-12-6-4-3-5-7-12/h3-11H,2H2,1H3/b9-8+,21-18- |
| InChIKey | GRCGYLXTOBYUNN-ABFCITCQSA-N |
| XLogP | 4.14 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|