C19H16Cl2N2O2S — CID 40886412
(E)-N-[4,6-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-phenylprop-2-enamide (PubChem CID 40886412) has the molecular formula C19H16Cl2N2O2S and a molecular weight of 407.32 g/mol. Its IUPAC name is (E)-N-[4,6-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[4,6-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 40886412 |
| Molecular Formula | C19H16Cl2N2O2S |
| Molecular Weight | 407.32 g/mol |
| Exact Mass | 406.03 |
| IUPAC Name | (E)-N-[4,6-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-phenylprop-2-enamide |
| SMILES | COCCn1/c(=N/C(=O)/C=C/c2ccccc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C19H16Cl2N2O2S/c1-25-10-9-23-18-15(21)11-14(20)12-16(18)26-19(23)22-17(24)8-7-13-5-3-2-4-6-13/h2-8,11-12H,9-10H2,1H3/b8-7+,22-19- |
| InChIKey | MDRVLQXQQPXOCS-YWXSNMJCSA-N |
| XLogP | 4.80 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.32 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|