C21H22N2O2S — CID 74744558
N-[3-(2-methoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-3-phenylprop-2-enamide (PubChem CID 74744558) has the molecular formula C21H22N2O2S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[3-(2-methoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-3-phenylprop-2-enamide.
| Compound Name | N-[3-(2-methoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 74744558 |
| Molecular Formula | C21H22N2O2S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.14 |
| IUPAC Name | N-[3-(2-methoxyethyl)-5,6-dimethyl-1,3-benzothiazol-2-ylidene]-3-phenylprop-2-enamide |
| SMILES | COCCn1/c(=N/C(=O)C=Cc2ccccc2)sc2cc(C)c(C)cc21 |
| InChI | InChI=1S/C21H22N2O2S/c1-15-13-18-19(14-16(15)2)26-21(23(18)11-12-25-3)22-20(24)10-9-17-7-5-4-6-8-17/h4-10,13-14H,11-12H2,1-3H3/b10-9?,22-21- |
| InChIKey | UKBBRTCOJVGGEK-QYHFIIHKSA-N |
| XLogP | 4.11 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|