C17H14Cl2N2O2S2 — CID 78704990
N-[4,5-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide (PubChem CID 78704990) has the molecular formula C17H14Cl2N2O2S2 and a molecular weight of 413.35 g/mol. Its IUPAC name is N-[4,5-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide.
| Compound Name | N-[4,5-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
|---|---|
| PubChem CID | 78704990 |
| Molecular Formula | C17H14Cl2N2O2S2 |
| Molecular Weight | 413.35 g/mol |
| Exact Mass | 411.99 |
| IUPAC Name | N-[4,5-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-3-thiophen-2-ylprop-2-enamide |
| SMILES | COCCn1/c(=N/C(=O)C=Cc2cccs2)sc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C17H14Cl2N2O2S2/c1-23-9-8-21-16-13(6-5-12(18)15(16)19)25-17(21)20-14(22)7-4-11-3-2-10-24-11/h2-7,10H,8-9H2,1H3/b7-4?,20-17- |
| InChIKey | MDMVYRJRHPBMTJ-XFLYMOMTSA-N |
| XLogP | 4.86 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.35 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|