C19H13Cl3N2O3S — CID 43942098
methyl 2-[4,5-dichloro-2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 43942098) has the molecular formula C19H13Cl3N2O3S and a molecular weight of 455.75 g/mol. Its IUPAC name is methyl 2-[4,5-dichloro-2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | methyl 2-[4,5-dichloro-2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43942098 |
| Molecular Formula | C19H13Cl3N2O3S |
| Molecular Weight | 455.75 g/mol |
| Exact Mass | 453.97 |
| IUPAC Name | methyl 2-[4,5-dichloro-2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | COC(=O)Cn1/c(=N/C(=O)/C=C/c2ccccc2Cl)sc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C19H13Cl3N2O3S/c1-27-16(26)10-24-18-14(8-7-13(21)17(18)22)28-19(24)23-15(25)9-6-11-4-2-3-5-12(11)20/h2-9H,10H2,1H3/b9-6+,23-19- |
| InChIKey | QVKNJLFYNQEVKB-CAMHVTRGSA-N |
| XLogP | 4.98 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.75 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|