C20H16BrClN2O3S — CID 4078632
ethyl 2-[6-bromo-2-[3-(2-chlorophenyl)prop-2-enoylimino]-1,3-benzothiazol-3-yl]acetate (PubChem CID 4078632) has the molecular formula C20H16BrClN2O3S and a molecular weight of 479.78 g/mol. Its IUPAC name is ethyl 2-[6-bromo-2-[3-(2-chlorophenyl)prop-2-enoylimino]-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[6-bromo-2-[3-(2-chlorophenyl)prop-2-enoylimino]-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 4078632 |
| Molecular Formula | C20H16BrClN2O3S |
| Molecular Weight | 479.78 g/mol |
| Exact Mass | 477.98 |
| IUPAC Name | ethyl 2-[6-bromo-2-[3-(2-chlorophenyl)prop-2-enoylimino]-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)C=Cc2ccccc2Cl)sc2cc(Br)ccc21 |
| InChI | InChI=1S/C20H16BrClN2O3S/c1-2-27-19(26)12-24-16-9-8-14(21)11-17(16)28-20(24)23-18(25)10-7-13-5-3-4-6-15(13)22/h3-11H,2,12H2,1H3/b10-7?,23-20- |
| InChIKey | GFZDDEMRPRRWTP-SWLMDAQNSA-N |
| XLogP | 4.82 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.78 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|