C18H14Cl2N2OS — CID 3450724
N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-(2-chlorophenyl)prop-2-enamide (PubChem CID 3450724) has the molecular formula C18H14Cl2N2OS and a molecular weight of 377.30 g/mol. Its IUPAC name is N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-(2-chlorophenyl)prop-2-enamide.
| Compound Name | N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-(2-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 3450724 |
| Molecular Formula | C18H14Cl2N2OS |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.02 |
| IUPAC Name | N-(6-chloro-3-ethyl-1,3-benzothiazol-2-ylidene)-3-(2-chlorophenyl)prop-2-enamide |
| SMILES | CCn1/c(=N/C(=O)C=Cc2ccccc2Cl)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C18H14Cl2N2OS/c1-2-22-15-9-8-13(19)11-16(15)24-18(22)21-17(23)10-7-12-5-3-4-6-14(12)20/h3-11H,2H2,1H3/b10-7?,21-18- |
| InChIKey | QFRMIUCKAOQIHU-CKQXOTDWSA-N |
| XLogP | 5.17 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|