C22H17ClN2O3S — CID 40903168
ethyl 2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 40903168) has the molecular formula C22H17ClN2O3S and a molecular weight of 424.91 g/mol. Its IUPAC name is ethyl 2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 40903168 |
| Molecular Formula | C22H17ClN2O3S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.06 |
| IUPAC Name | ethyl 2-[(E)-3-(2-chlorophenyl)prop-2-enoyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)/C=C/c2ccccc2Cl)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C22H17ClN2O3S/c1-3-13-25-18-11-9-16(21(27)28-4-2)14-19(18)29-22(25)24-20(26)12-10-15-7-5-6-8-17(15)23/h1,5-12,14H,4,13H2,2H3/b12-10+,24-22- |
| InChIKey | HKQQRLVPWRTULW-HYGMHYJRSA-N |
| XLogP | 4.31 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|