C23H22N2O5S — CID 43945012
ethyl 2-[2-(4-ethoxyphenoxy)acetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 43945012) has the molecular formula C23H22N2O5S and a molecular weight of 438.51 g/mol. Its IUPAC name is ethyl 2-[2-(4-ethoxyphenoxy)acetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[2-(4-ethoxyphenoxy)acetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 43945012 |
| Molecular Formula | C23H22N2O5S |
| Molecular Weight | 438.51 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | ethyl 2-[2-(4-ethoxyphenoxy)acetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)COc2ccc(OCC)cc2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C23H22N2O5S/c1-4-13-25-19-12-7-16(22(27)29-6-3)14-20(19)31-23(25)24-21(26)15-30-18-10-8-17(9-11-18)28-5-2/h1,7-12,14H,5-6,13,15H2,2-3H3/b24-23- |
| InChIKey | KOLWONUHWAFJPU-VHXPQNKSSA-N |
| XLogP | 3.42 |
| TPSA | 79.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.51 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|