C22H25N3O6S2 — CID 4169276
ethyl 2-[2-(2-oxo-2-piperidin-1-ylethyl)sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate (PubChem CID 4169276) has the molecular formula C22H25N3O6S2 and a molecular weight of 491.59 g/mol. Its IUPAC name is ethyl 2-[2-(2-oxo-2-piperidin-1-ylethyl)sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[2-(2-oxo-2-piperidin-1-ylethyl)sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4169276 |
| Molecular Formula | C22H25N3O6S2 |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | ethyl 2-[2-(2-oxo-2-piperidin-1-ylethyl)sulfonylacetyl]imino-3-prop-2-ynyl-1,3-benzothiazole-6-carboxylate |
| SMILES | C#CCn1/c(=N/C(=O)CS(=O)(=O)CC(=O)N2CCCCC2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C22H25N3O6S2/c1-3-10-25-17-9-8-16(21(28)31-4-2)13-18(17)32-22(25)23-19(26)14-33(29,30)15-20(27)24-11-6-5-7-12-24/h1,8-9,13H,4-7,10-12,14-15H2,2H3/b23-22- |
| InChIKey | ZSQCWHBJXUGCTH-FCQUAONHSA-N |
| XLogP | 1.37 |
| TPSA | 115.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|