C20H27N3O5S2 — CID 5056392
N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfonylacetamide (PubChem CID 5056392) has the molecular formula C20H27N3O5S2 and a molecular weight of 453.59 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfonylacetamide.
| Compound Name | N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfonylacetamide |
|---|---|
| PubChem CID | 5056392 |
| Molecular Formula | C20H27N3O5S2 |
| Molecular Weight | 453.59 g/mol |
| Exact Mass | 453.14 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-6-methyl-1,3-benzothiazol-2-ylidene]-2-(2-oxo-2-pyrrolidin-1-ylethyl)sulfonylacetamide |
| SMILES | CCOCCn1/c(=N/C(=O)CS(=O)(=O)CC(=O)N2CCCC2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C20H27N3O5S2/c1-3-28-11-10-23-16-7-6-15(2)12-17(16)29-20(23)21-18(24)13-30(26,27)14-19(25)22-8-4-5-9-22/h6-7,12H,3-5,8-11,13-14H2,1-2H3/b21-20- |
| InChIKey | FBEAKNUPFLFBFO-MRCUWXFGSA-N |
| XLogP | 1.51 |
| TPSA | 98.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.59 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|