C18H22N2O7S2 — CID 3250975
ethyl 2-(2-acetylsulfonylacetyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 3250975) has the molecular formula C18H22N2O7S2 and a molecular weight of 442.52 g/mol. Its IUPAC name is ethyl 2-(2-acetylsulfonylacetyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-(2-acetylsulfonylacetyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 3250975 |
| Molecular Formula | C18H22N2O7S2 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | ethyl 2-(2-acetylsulfonylacetyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)CS(=O)(=O)C(C)=O)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C18H22N2O7S2/c1-4-26-9-8-20-14-7-6-13(17(23)27-5-2)10-15(14)28-18(20)19-16(22)11-29(24,25)12(3)21/h6-7,10H,4-5,8-9,11H2,1-3H3/b19-18- |
| InChIKey | WUNDMVAXAYAGNR-HNENSFHCSA-N |
| XLogP | 1.30 |
| TPSA | 121.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|