C18H20N2O5S3 — CID 40892379
ethyl 3-(2-ethoxyethyl)-2-thiophen-2-ylsulfonylimino-1,3-benzothiazole-6-carboxylate (PubChem CID 40892379) has the molecular formula C18H20N2O5S3 and a molecular weight of 440.57 g/mol. Its IUPAC name is ethyl 3-(2-ethoxyethyl)-2-thiophen-2-ylsulfonylimino-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 3-(2-ethoxyethyl)-2-thiophen-2-ylsulfonylimino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 40892379 |
| Molecular Formula | C18H20N2O5S3 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.05 |
| IUPAC Name | ethyl 3-(2-ethoxyethyl)-2-thiophen-2-ylsulfonylimino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1c(=NS(=O)(=O)c2cccs2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C18H20N2O5S3/c1-3-24-10-9-20-14-8-7-13(17(21)25-4-2)12-15(14)27-18(20)19-28(22,23)16-6-5-11-26-16/h5-8,11-12H,3-4,9-10H2,1-2H3 |
| InChIKey | BPWJACMLZUGCNT-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 86.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|