C15H16N2O3S3 — CID 16938080
(NZ)-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide (PubChem CID 16938080) has the molecular formula C15H16N2O3S3 and a molecular weight of 368.51 g/mol. Its IUPAC name is (NZ)-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | (NZ)-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 16938080 |
| Molecular Formula | C15H16N2O3S3 |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.03 |
| IUPAC Name | (NZ)-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide |
| SMILES | CCOCCn1/c(=N/S(=O)(=O)c2cccs2)sc2ccccc21 |
| InChI | InChI=1S/C15H16N2O3S3/c1-2-20-10-9-17-12-6-3-4-7-13(12)22-15(17)16-23(18,19)14-8-5-11-21-14/h3-8,11H,2,9-10H2,1H3/b16-15- |
| InChIKey | GYDLNRVZGFBZRK-NXVVXOECSA-N |
| XLogP | 3.09 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|