C15H15ClN2O3S3 — CID 40892562
5-chloro-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide (PubChem CID 40892562) has the molecular formula C15H15ClN2O3S3 and a molecular weight of 402.95 g/mol. Its IUPAC name is 5-chloro-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 40892562 |
| Molecular Formula | C15H15ClN2O3S3 |
| Molecular Weight | 402.95 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | 5-chloro-N-[3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide |
| SMILES | CCOCCn1c(=NS(=O)(=O)c2ccc(Cl)s2)sc2ccccc21 |
| InChI | InChI=1S/C15H15ClN2O3S3/c1-2-21-10-9-18-11-5-3-4-6-12(11)22-15(18)17-24(19,20)14-8-7-13(16)23-14/h3-8H,2,9-10H2,1H3 |
| InChIKey | DAZXNHNQOTWXJB-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.95 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|