C15H13ClF2N2O3S3 — CID 40892574
5-chloro-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide (PubChem CID 40892574) has the molecular formula C15H13ClF2N2O3S3 and a molecular weight of 438.93 g/mol. Its IUPAC name is 5-chloro-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide.
| Compound Name | 5-chloro-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 40892574 |
| Molecular Formula | C15H13ClF2N2O3S3 |
| Molecular Weight | 438.93 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | 5-chloro-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]thiophene-2-sulfonamide |
| SMILES | CCOCCn1c(=NS(=O)(=O)c2ccc(Cl)s2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C15H13ClF2N2O3S3/c1-2-23-6-5-20-14-10(18)7-9(17)8-11(14)24-15(20)19-26(21,22)13-4-3-12(16)25-13/h3-4,7-8H,2,5-6H2,1H3 |
| InChIKey | BSNDGIVUOJODQC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 60.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.93 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|