C21H21ClF2N2O4S2 — CID 25407707
4-(4-chlorophenyl)sulfonyl-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]butanamide (PubChem CID 25407707) has the molecular formula C21H21ClF2N2O4S2 and a molecular weight of 502.99 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfonyl-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfonyl-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]butanamide |
|---|---|
| PubChem CID | 25407707 |
| Molecular Formula | C21H21ClF2N2O4S2 |
| Molecular Weight | 502.99 g/mol |
| Exact Mass | 502.06 |
| IUPAC Name | 4-(4-chlorophenyl)sulfonyl-N-[3-(2-ethoxyethyl)-4,6-difluoro-1,3-benzothiazol-2-ylidene]butanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccc(Cl)cc2)sc2cc(F)cc(F)c21 |
| InChI | InChI=1S/C21H21ClF2N2O4S2/c1-2-30-10-9-26-20-17(24)12-15(23)13-18(20)31-21(26)25-19(27)4-3-11-32(28,29)16-7-5-14(22)6-8-16/h5-8,12-13H,2-4,9-11H2,1H3/b25-21- |
| InChIKey | KJRDRKVMMWCUCW-DAFNUICNSA-N |
| XLogP | 4.35 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.99 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|