C22H24Cl2N2O4S2 — CID 25407079
N-[4,7-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfonylbutanamide (PubChem CID 25407079) has the molecular formula C22H24Cl2N2O4S2 and a molecular weight of 515.48 g/mol. Its IUPAC name is N-[4,7-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfonylbutanamide.
| Compound Name | N-[4,7-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfonylbutanamide |
|---|---|
| PubChem CID | 25407079 |
| Molecular Formula | C22H24Cl2N2O4S2 |
| Molecular Weight | 515.48 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | N-[4,7-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(4-methylphenyl)sulfonylbutanamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCCS(=O)(=O)c2ccc(C)cc2)sc2c(Cl)ccc(Cl)c21 |
| InChI | InChI=1S/C22H24Cl2N2O4S2/c1-3-30-13-12-26-20-17(23)10-11-18(24)21(20)31-22(26)25-19(27)5-4-14-32(28,29)16-8-6-15(2)7-9-16/h6-11H,3-5,12-14H2,1-2H3/b25-22- |
| InChIKey | UOYWOHSCVOXUTH-LVWGJNHUSA-N |
| XLogP | 5.04 |
| TPSA | 77.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|