C34H44Cl2N4O4S2 — CID 43939553
N,N'-bis[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]decanediamide (PubChem CID 43939553) has the molecular formula C34H44Cl2N4O4S2 and a molecular weight of 707.79 g/mol. Its IUPAC name is N,N'-bis[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]decanediamide.
| Compound Name | N,N'-bis[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]decanediamide |
|---|---|
| PubChem CID | 43939553 |
| Molecular Formula | C34H44Cl2N4O4S2 |
| Molecular Weight | 707.79 g/mol |
| Exact Mass | 706.22 |
| IUPAC Name | N,N'-bis[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]decanediamide |
| SMILES | CCOCCn1/c(=N/C(=O)CCCCCCCCC(=O)/N=c2\sc3ccc(Cl)c(C)c3n2CCOCC)sc2ccc(Cl)c(C)c21 |
| InChI | InChI=1S/C34H44Cl2N4O4S2/c1-5-43-21-19-39-31-23(3)25(35)15-17-27(31)45-33(39)37-29(41)13-11-9-7-8-10-12-14-30(42)38-34-40(20-22-44-6-2)32-24(4)26(36)16-18-28(32)46-34/h15-18H,5-14,19-22H2,1-4H3/b37-33-,38-34- |
| InChIKey | HTEZXLVPORWNCI-ZHTVLWRQSA-N |
| XLogP | 8.39 |
| TPSA | 87.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 707.79 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|