C24H30ClN3O4S2 — CID 41203375
4-[butyl(methyl)sulfamoyl]-N-[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 41203375) has the molecular formula C24H30ClN3O4S2 and a molecular weight of 524.11 g/mol. Its IUPAC name is 4-[butyl(methyl)sulfamoyl]-N-[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[butyl(methyl)sulfamoyl]-N-[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 41203375 |
| Molecular Formula | C24H30ClN3O4S2 |
| Molecular Weight | 524.11 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 4-[butyl(methyl)sulfamoyl]-N-[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCCCN(C)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3ccc(Cl)c(C)c3n2CCOCC)cc1 |
| InChI | InChI=1S/C24H30ClN3O4S2/c1-5-7-14-27(4)34(30,31)19-10-8-18(9-11-19)23(29)26-24-28(15-16-32-6-2)22-17(3)20(25)12-13-21(22)33-24/h8-13H,5-7,14-16H2,1-4H3/b26-24- |
| InChIKey | JKDVUGCJXHVZQZ-LCUIJRPUSA-N |
| XLogP | 4.86 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.11 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|