C21H23ClN2O4S — CID 41202679
N-[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]-3,4-dimethoxybenzamide (PubChem CID 41202679) has the molecular formula C21H23ClN2O4S and a molecular weight of 434.95 g/mol. Its IUPAC name is N-[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]-3,4-dimethoxybenzamide.
| Compound Name | N-[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 41202679 |
| Molecular Formula | C21H23ClN2O4S |
| Molecular Weight | 434.95 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | N-[5-chloro-3-(2-ethoxyethyl)-4-methyl-1,3-benzothiazol-2-ylidene]-3,4-dimethoxybenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(OC)c(OC)c2)sc2ccc(Cl)c(C)c21 |
| InChI | InChI=1S/C21H23ClN2O4S/c1-5-28-11-10-24-19-13(2)15(22)7-9-18(19)29-21(24)23-20(25)14-6-8-16(26-3)17(12-14)27-4/h6-9,12H,5,10-11H2,1-4H3/b23-21- |
| InChIKey | MMFDROVCUGCQNU-LNVKXUELSA-N |
| XLogP | 4.46 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.95 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|