C18H15Cl3N2O2S — CID 43939019
4-chloro-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 43939019) has the molecular formula C18H15Cl3N2O2S and a molecular weight of 429.76 g/mol. Its IUPAC name is 4-chloro-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-chloro-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 43939019 |
| Molecular Formula | C18H15Cl3N2O2S |
| Molecular Weight | 429.76 g/mol |
| Exact Mass | 427.99 |
| IUPAC Name | 4-chloro-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(Cl)cc2)sc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C18H15Cl3N2O2S/c1-2-25-10-9-23-16-14(8-7-13(20)15(16)21)26-18(23)22-17(24)11-3-5-12(19)6-4-11/h3-8H,2,9-10H2,1H3/b22-18- |
| InChIKey | CKIUAAZQXSMJTD-PYCFMQQDSA-N |
| XLogP | 5.44 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.76 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|