C18H14Cl3N3O4S — CID 41203429
2-chloro-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitrobenzamide (PubChem CID 41203429) has the molecular formula C18H14Cl3N3O4S and a molecular weight of 474.75 g/mol. Its IUPAC name is 2-chloro-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitrobenzamide.
| Compound Name | 2-chloro-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitrobenzamide |
|---|---|
| PubChem CID | 41203429 |
| Molecular Formula | C18H14Cl3N3O4S |
| Molecular Weight | 474.75 g/mol |
| Exact Mass | 472.98 |
| IUPAC Name | 2-chloro-N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-5-nitrobenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2cc([N+](=O)[O-])ccc2Cl)sc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C18H14Cl3N3O4S/c1-2-28-8-7-23-16-14(6-5-13(20)15(16)21)29-18(23)22-17(25)11-9-10(24(26)27)3-4-12(11)19/h3-6,9H,2,7-8H2,1H3/b22-18- |
| InChIKey | VSDAKVOVSITQHY-PYCFMQQDSA-N |
| XLogP | 5.35 |
| TPSA | 86.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.75 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|