C20H13Cl2N3O5S2 — CID 43941616
ethyl 2-[4,5-dichloro-2-(5-nitro-1-benzothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate (PubChem CID 43941616) has the molecular formula C20H13Cl2N3O5S2 and a molecular weight of 510.38 g/mol. Its IUPAC name is ethyl 2-[4,5-dichloro-2-(5-nitro-1-benzothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate.
| Compound Name | ethyl 2-[4,5-dichloro-2-(5-nitro-1-benzothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
|---|---|
| PubChem CID | 43941616 |
| Molecular Formula | C20H13Cl2N3O5S2 |
| Molecular Weight | 510.38 g/mol |
| Exact Mass | 508.97 |
| IUPAC Name | ethyl 2-[4,5-dichloro-2-(5-nitro-1-benzothiophene-2-carbonyl)imino-1,3-benzothiazol-3-yl]acetate |
| SMILES | CCOC(=O)Cn1/c(=N/C(=O)c2cc3cc([N+](=O)[O-])ccc3s2)sc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C20H13Cl2N3O5S2/c1-2-30-16(26)9-24-18-14(6-4-12(21)17(18)22)32-20(24)23-19(27)15-8-10-7-11(25(28)29)3-5-13(10)31-15/h3-8H,2,9H2,1H3/b23-20- |
| InChIKey | KDIUKELDMAJCQD-ATJXCDBQSA-N |
| XLogP | 5.44 |
| TPSA | 103.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.38 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|