C17H17Cl2N3O4S — CID 41203282
N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2,5-dioxopyrrolidin-1-yl)acetamide (PubChem CID 41203282) has the molecular formula C17H17Cl2N3O4S and a molecular weight of 430.31 g/mol. Its IUPAC name is N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2,5-dioxopyrrolidin-1-yl)acetamide.
| Compound Name | N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 41203282 |
| Molecular Formula | C17H17Cl2N3O4S |
| Molecular Weight | 430.31 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | N-[4,5-dichloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-2-(2,5-dioxopyrrolidin-1-yl)acetamide |
| SMILES | CCOCCn1/c(=N/C(=O)CN2C(=O)CCC2=O)sc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C17H17Cl2N3O4S/c1-2-26-8-7-21-16-11(4-3-10(18)15(16)19)27-17(21)20-12(23)9-22-13(24)5-6-14(22)25/h3-4H,2,5-9H2,1H3/b20-17- |
| InChIKey | MBBJAPSBEBDIDB-JZJYNLBNSA-N |
| XLogP | 2.62 |
| TPSA | 80.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.31 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|