C30H34Cl4N4O4S2 — CID 43939001
N,N'-bis[4,5-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]decanediamide (PubChem CID 43939001) has the molecular formula C30H34Cl4N4O4S2 and a molecular weight of 720.57 g/mol. Its IUPAC name is N,N'-bis[4,5-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]decanediamide.
| Compound Name | N,N'-bis[4,5-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]decanediamide |
|---|---|
| PubChem CID | 43939001 |
| Molecular Formula | C30H34Cl4N4O4S2 |
| Molecular Weight | 720.57 g/mol |
| Exact Mass | 718.08 |
| IUPAC Name | N,N'-bis[4,5-dichloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]decanediamide |
| SMILES | COCCn1/c(=N/C(=O)CCCCCCCCC(=O)/N=c2\sc3ccc(Cl)c(Cl)c3n2CCOC)sc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C30H34Cl4N4O4S2/c1-41-17-15-37-27-21(13-11-19(31)25(27)33)43-29(37)35-23(39)9-7-5-3-4-6-8-10-24(40)36-30-38(16-18-42-2)28-22(44-30)14-12-20(32)26(28)34/h11-14H,3-10,15-18H2,1-2H3/b35-29-,36-30- |
| InChIKey | LCMDZILZNLHHIC-YSVNBZGQSA-N |
| XLogP | 8.30 |
| TPSA | 87.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.57 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|