C30H30Cl4N4O2S2 — CID 43944756
N,N'-bis(4,5-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)decanediamide (PubChem CID 43944756) has the molecular formula C30H30Cl4N4O2S2 and a molecular weight of 684.54 g/mol. Its IUPAC name is N,N'-bis(4,5-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)decanediamide.
| Compound Name | N,N'-bis(4,5-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)decanediamide |
|---|---|
| PubChem CID | 43944756 |
| Molecular Formula | C30H30Cl4N4O2S2 |
| Molecular Weight | 684.54 g/mol |
| Exact Mass | 682.06 |
| IUPAC Name | N,N'-bis(4,5-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)decanediamide |
| SMILES | C=CCn1/c(=N/C(=O)CCCCCCCCC(=O)/N=c2\sc3ccc(Cl)c(Cl)c3n2CC=C)sc2ccc(Cl)c(Cl)c21 |
| InChI | InChI=1S/C30H30Cl4N4O2S2/c1-3-17-37-27-21(15-13-19(31)25(27)33)41-29(37)35-23(39)11-9-7-5-6-8-10-12-24(40)36-30-38(18-4-2)28-22(42-30)16-14-20(32)26(28)34/h3-4,13-16H,1-2,5-12,17-18H2/b35-29-,36-30- |
| InChIKey | ZPFPDEHUJYOYLQ-YSVNBZGQSA-N |
| XLogP | 9.38 |
| TPSA | 68.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.54 |
| LogP ≤ 5 | 9.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|