C19H16Cl2N2OS2 — CID 43944664
N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-phenylsulfanylpropanamide (PubChem CID 43944664) has the molecular formula C19H16Cl2N2OS2 and a molecular weight of 423.39 g/mol. Its IUPAC name is N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-phenylsulfanylpropanamide.
| Compound Name | N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-phenylsulfanylpropanamide |
|---|---|
| PubChem CID | 43944664 |
| Molecular Formula | C19H16Cl2N2OS2 |
| Molecular Weight | 423.39 g/mol |
| Exact Mass | 422.01 |
| IUPAC Name | N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-3-phenylsulfanylpropanamide |
| SMILES | C=CCn1/c(=N/C(=O)CCSc2ccccc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C19H16Cl2N2OS2/c1-2-9-23-18-15(21)11-13(20)12-16(18)26-19(23)22-17(24)8-10-25-14-6-4-3-5-7-14/h2-7,11-12H,1,8-10H2/b22-19- |
| InChIKey | IACSPMZHQSSJDT-QOCHGBHMSA-N |
| XLogP | 5.81 |
| TPSA | 34.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.39 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|