C24H19Cl2N3O3S2 — CID 43944396
N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-[methyl(phenyl)sulfamoyl]benzamide (PubChem CID 43944396) has the molecular formula C24H19Cl2N3O3S2 and a molecular weight of 532.47 g/mol. Its IUPAC name is N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-[methyl(phenyl)sulfamoyl]benzamide.
| Compound Name | N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-[methyl(phenyl)sulfamoyl]benzamide |
|---|---|
| PubChem CID | 43944396 |
| Molecular Formula | C24H19Cl2N3O3S2 |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 531.02 |
| IUPAC Name | N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)-4-[methyl(phenyl)sulfamoyl]benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(C)c3ccccc3)cc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C24H19Cl2N3O3S2/c1-3-13-29-22-20(26)14-17(25)15-21(22)33-24(29)27-23(30)16-9-11-19(12-10-16)34(31,32)28(2)18-7-5-4-6-8-18/h3-12,14-15H,1,13H2,2H3/b27-24- |
| InChIKey | LYODPKFZWZLKGU-PNHLSOANSA-N |
| XLogP | 5.76 |
| TPSA | 71.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|