C23H25Cl2N3O5S2 — CID 43944638
4-[bis(2-methoxyethyl)sulfamoyl]-N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 43944638) has the molecular formula C23H25Cl2N3O5S2 and a molecular weight of 558.51 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)sulfamoyl]-N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 43944638 |
| Molecular Formula | C23H25Cl2N3O5S2 |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 557.06 |
| IUPAC Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-(4,6-dichloro-3-prop-2-enyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C=CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CCOC)CCOC)cc2)sc2cc(Cl)cc(Cl)c21 |
| InChI | InChI=1S/C23H25Cl2N3O5S2/c1-4-9-28-21-19(25)14-17(24)15-20(21)34-23(28)26-22(29)16-5-7-18(8-6-16)35(30,31)27(10-12-32-2)11-13-33-3/h4-8,14-15H,1,9-13H2,2-3H3/b26-23- |
| InChIKey | NVIMQDBXVGASEA-RWEWTDSWSA-N |
| XLogP | 4.22 |
| TPSA | 90.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|