C24H30ClN3O6S2 — CID 3576950
4-[bis(2-methoxyethyl)sulfamoyl]-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 3576950) has the molecular formula C24H30ClN3O6S2 and a molecular weight of 556.11 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)sulfamoyl]-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 3576950 |
| Molecular Formula | C24H30ClN3O6S2 |
| Molecular Weight | 556.11 g/mol |
| Exact Mass | 555.13 |
| IUPAC Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-[6-chloro-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CCOC)CCOC)cc2)sc2cc(Cl)ccc21 |
| InChI | InChI=1S/C24H30ClN3O6S2/c1-4-34-16-13-28-21-10-7-19(25)17-22(21)35-24(28)26-23(29)18-5-8-20(9-6-18)36(30,31)27(11-14-32-2)12-15-33-3/h5-10,17H,4,11-16H2,1-3H3/b26-24- |
| InChIKey | GWMTWIFEHMOMHX-LCUIJRPUSA-N |
| XLogP | 3.42 |
| TPSA | 99.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.11 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|