C27H29N5O6S2 — CID 4117577
ethyl 2-[4-[bis(2-cyanoethyl)sulfamoyl]benzoyl]imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 4117577) has the molecular formula C27H29N5O6S2 and a molecular weight of 583.69 g/mol. Its IUPAC name is ethyl 2-[4-[bis(2-cyanoethyl)sulfamoyl]benzoyl]imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 2-[4-[bis(2-cyanoethyl)sulfamoyl]benzoyl]imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4117577 |
| Molecular Formula | C27H29N5O6S2 |
| Molecular Weight | 583.69 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | ethyl 2-[4-[bis(2-cyanoethyl)sulfamoyl]benzoyl]imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CCC#N)CCC#N)cc2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C27H29N5O6S2/c1-3-37-18-17-32-23-12-9-21(26(34)38-4-2)19-24(23)39-27(32)30-25(33)20-7-10-22(11-8-20)40(35,36)31(15-5-13-28)16-6-14-29/h7-12,19H,3-6,15-18H2,1-2H3/b30-27- |
| InChIKey | DBCGLRQBYYHCAL-IKPAITLHSA-N |
| XLogP | 3.48 |
| TPSA | 154.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.69 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|