C27H33N3O7S2 — CID 43946838
ethyl 3-(2-ethoxyethyl)-2-[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]imino-1,3-benzothiazole-6-carboxylate (PubChem CID 43946838) has the molecular formula C27H33N3O7S2 and a molecular weight of 575.71 g/mol. Its IUPAC name is ethyl 3-(2-ethoxyethyl)-2-[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 3-(2-ethoxyethyl)-2-[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 43946838 |
| Molecular Formula | C27H33N3O7S2 |
| Molecular Weight | 575.71 g/mol |
| Exact Mass | 575.18 |
| IUPAC Name | ethyl 3-(2-ethoxyethyl)-2-[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(C)CC3CCCO3)cc2)sc2cc(C(=O)OCC)ccc21 |
| InChI | InChI=1S/C27H33N3O7S2/c1-4-35-16-14-30-23-13-10-20(26(32)36-5-2)17-24(23)38-27(30)28-25(31)19-8-11-22(12-9-19)39(33,34)29(3)18-21-7-6-15-37-21/h8-13,17,21H,4-7,14-16,18H2,1-3H3/b28-27- |
| InChIKey | UUOGROZTSRLUQA-DQSJHHFOSA-N |
| XLogP | 3.46 |
| TPSA | 116.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.71 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|