C26H31N3O7S2 — CID 43946840
methyl 3-(2-ethoxyethyl)-2-[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]imino-1,3-benzothiazole-6-carboxylate (PubChem CID 43946840) has the molecular formula C26H31N3O7S2 and a molecular weight of 561.68 g/mol. Its IUPAC name is methyl 3-(2-ethoxyethyl)-2-[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 3-(2-ethoxyethyl)-2-[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 43946840 |
| Molecular Formula | C26H31N3O7S2 |
| Molecular Weight | 561.68 g/mol |
| Exact Mass | 561.16 |
| IUPAC Name | methyl 3-(2-ethoxyethyl)-2-[4-[methyl(oxolan-2-ylmethyl)sulfamoyl]benzoyl]imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(C)CC3CCCO3)cc2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C26H31N3O7S2/c1-4-35-15-13-29-22-12-9-19(25(31)34-3)16-23(22)37-26(29)27-24(30)18-7-10-21(11-8-18)38(32,33)28(2)17-20-6-5-14-36-20/h7-12,16,20H,4-6,13-15,17H2,1-3H3/b27-26- |
| InChIKey | SWVAIEKTHIRINL-RQZHXJHFSA-N |
| XLogP | 3.07 |
| TPSA | 116.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.68 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|