C24H28N2O4S — CID 5081786
methyl 2-(4-tert-butylbenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate (PubChem CID 5081786) has the molecular formula C24H28N2O4S and a molecular weight of 440.57 g/mol. Its IUPAC name is methyl 2-(4-tert-butylbenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate.
| Compound Name | methyl 2-(4-tert-butylbenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 5081786 |
| Molecular Formula | C24H28N2O4S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | methyl 2-(4-tert-butylbenzoyl)imino-3-(2-ethoxyethyl)-1,3-benzothiazole-6-carboxylate |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(C(C)(C)C)cc2)sc2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C24H28N2O4S/c1-6-30-14-13-26-19-12-9-17(22(28)29-5)15-20(19)31-23(26)25-21(27)16-7-10-18(11-8-16)24(2,3)4/h7-12,15H,6,13-14H2,1-5H3/b25-23- |
| InChIKey | YZMXIXSKJDXXNO-BZZOAKBMSA-N |
| XLogP | 4.56 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|