C24H21N5O3S2 — CID 4638313
4-[bis(2-cyanoethyl)sulfamoyl]-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide (PubChem CID 4638313) has the molecular formula C24H21N5O3S2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 4-[bis(2-cyanoethyl)sulfamoyl]-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide.
| Compound Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
|---|---|
| PubChem CID | 4638313 |
| Molecular Formula | C24H21N5O3S2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.11 |
| IUPAC Name | 4-[bis(2-cyanoethyl)sulfamoyl]-N-(6-methyl-3-prop-2-ynyl-1,3-benzothiazol-2-ylidene)benzamide |
| SMILES | C#CCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CCC#N)CCC#N)cc2)sc2cc(C)ccc21 |
| InChI | InChI=1S/C24H21N5O3S2/c1-3-14-29-21-11-6-18(2)17-22(21)33-24(29)27-23(30)19-7-9-20(10-8-19)34(31,32)28(15-4-12-25)16-5-13-26/h1,6-11,17H,4-5,14-16H2,2H3/b27-24- |
| InChIKey | NJZXWADTEHCFRJ-PNHLSOANSA-N |
| XLogP | 3.20 |
| TPSA | 119.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|