C26H34N4O5S2 — CID 3456234
N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(dipropylsulfamoyl)benzamide (PubChem CID 3456234) has the molecular formula C26H34N4O5S2 and a molecular weight of 546.72 g/mol. Its IUPAC name is N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(dipropylsulfamoyl)benzamide.
| Compound Name | N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(dipropylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 3456234 |
| Molecular Formula | C26H34N4O5S2 |
| Molecular Weight | 546.72 g/mol |
| Exact Mass | 546.20 |
| IUPAC Name | N-[6-acetamido-3-(2-ethoxyethyl)-1,3-benzothiazol-2-ylidene]-4-(dipropylsulfamoyl)benzamide |
| SMILES | CCCN(CCC)S(=O)(=O)c1ccc(C(=O)/N=c2\sc3cc(NC(C)=O)ccc3n2CCOCC)cc1 |
| InChI | InChI=1S/C26H34N4O5S2/c1-5-14-29(15-6-2)37(33,34)22-11-8-20(9-12-22)25(32)28-26-30(16-17-35-7-3)23-13-10-21(27-19(4)31)18-24(23)36-26/h8-13,18H,5-7,14-17H2,1-4H3,(H,27,31)/b28-26- |
| InChIKey | QGLIHZOCCCQTKP-SGEDCAFJSA-N |
| XLogP | 4.25 |
| TPSA | 110.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.72 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|