C26H35N3O6S2 — CID 43939489
4-[bis(2-methoxyethyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 43939489) has the molecular formula C26H35N3O6S2 and a molecular weight of 549.72 g/mol. Its IUPAC name is 4-[bis(2-methoxyethyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 43939489 |
| Molecular Formula | C26H35N3O6S2 |
| Molecular Weight | 549.72 g/mol |
| Exact Mass | 549.20 |
| IUPAC Name | 4-[bis(2-methoxyethyl)sulfamoyl]-N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(S(=O)(=O)N(CCOC)CCOC)cc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C26H35N3O6S2/c1-6-35-16-13-29-23-18-19(2)17-20(3)24(23)36-26(29)27-25(30)21-7-9-22(10-8-21)37(31,32)28(11-14-33-4)12-15-34-5/h7-10,17-18H,6,11-16H2,1-5H3/b27-26- |
| InChIKey | DSWXALFBFZNNAW-RQZHXJHFSA-N |
| XLogP | 3.38 |
| TPSA | 99.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.72 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|