C23H28N2O3S — CID 41203294
N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]-4-propan-2-yloxybenzamide (PubChem CID 41203294) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]-4-propan-2-yloxybenzamide.
| Compound Name | N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]-4-propan-2-yloxybenzamide |
|---|---|
| PubChem CID | 41203294 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | N-[3-(2-ethoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]-4-propan-2-yloxybenzamide |
| SMILES | CCOCCn1/c(=N/C(=O)c2ccc(OC(C)C)cc2)sc2c(C)cc(C)cc21 |
| InChI | InChI=1S/C23H28N2O3S/c1-6-27-12-11-25-20-14-16(4)13-17(5)21(20)29-23(25)24-22(26)18-7-9-19(10-8-18)28-15(2)3/h7-10,13-15H,6,11-12H2,1-5H3/b24-23- |
| InChIKey | VWDYXIWYDZEZTE-VHXPQNKSSA-N |
| XLogP | 4.88 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|