C23H28N2O3S — CID 40888260
3-butoxy-N-[3-(2-methoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide (PubChem CID 40888260) has the molecular formula C23H28N2O3S and a molecular weight of 412.56 g/mol. Its IUPAC name is 3-butoxy-N-[3-(2-methoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide.
| Compound Name | 3-butoxy-N-[3-(2-methoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide |
|---|---|
| PubChem CID | 40888260 |
| Molecular Formula | C23H28N2O3S |
| Molecular Weight | 412.56 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | 3-butoxy-N-[3-(2-methoxyethyl)-5,7-dimethyl-1,3-benzothiazol-2-ylidene]benzamide |
| SMILES | CCCCOc1cccc(C(=O)/N=c2\sc3c(C)cc(C)cc3n2CCOC)c1 |
| InChI | InChI=1S/C23H28N2O3S/c1-5-6-11-28-19-9-7-8-18(15-19)22(26)24-23-25(10-12-27-4)20-14-16(2)13-17(3)21(20)29-23/h7-9,13-15H,5-6,10-12H2,1-4H3/b24-23- |
| InChIKey | QBXDBFSCCKLBAR-VHXPQNKSSA-N |
| XLogP | 4.89 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.56 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|