C23H28N2O2S2 — CID 30680347
N-[6-methyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-3-pentoxybenzamide (PubChem CID 30680347) has the molecular formula C23H28N2O2S2 and a molecular weight of 428.62 g/mol. Its IUPAC name is N-[6-methyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-3-pentoxybenzamide.
| Compound Name | N-[6-methyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-3-pentoxybenzamide |
|---|---|
| PubChem CID | 30680347 |
| Molecular Formula | C23H28N2O2S2 |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | N-[6-methyl-3-(2-methylsulfanylethyl)-1,3-benzothiazol-2-ylidene]-3-pentoxybenzamide |
| SMILES | CCCCCOc1cccc(C(=O)/N=c2\sc3cc(C)ccc3n2CCSC)c1 |
| InChI | InChI=1S/C23H28N2O2S2/c1-4-5-6-13-27-19-9-7-8-18(16-19)22(26)24-23-25(12-14-28-3)20-11-10-17(2)15-21(20)29-23/h7-11,15-16H,4-6,12-14H2,1-3H3/b24-23- |
| InChIKey | GNACEDZUUBZBGY-VHXPQNKSSA-N |
| XLogP | 5.68 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|