C23H26N2O4S2 — CID 30680588
N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]-3-pentoxybenzamide (PubChem CID 30680588) has the molecular formula C23H26N2O4S2 and a molecular weight of 458.61 g/mol. Its IUPAC name is N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]-3-pentoxybenzamide.
| Compound Name | N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]-3-pentoxybenzamide |
|---|---|
| PubChem CID | 30680588 |
| Molecular Formula | C23H26N2O4S2 |
| Molecular Weight | 458.61 g/mol |
| Exact Mass | 458.13 |
| IUPAC Name | N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]-3-pentoxybenzamide |
| SMILES | CCCCCOc1cccc(C(=O)/N=c2\sc3cc4c(cc3n2CCSC)OCO4)c1 |
| InChI | InChI=1S/C23H26N2O4S2/c1-3-4-5-10-27-17-8-6-7-16(12-17)22(26)24-23-25(9-11-30-2)18-13-19-20(29-15-28-19)14-21(18)31-23/h6-8,12-14H,3-5,9-11,15H2,1-2H3/b24-23- |
| InChIKey | AWHVCKCDNBCQKL-VHXPQNKSSA-N |
| XLogP | 5.10 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.61 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|