C22H24N2O4S2 — CID 41126037
4-butoxy-N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]benzamide (PubChem CID 41126037) has the molecular formula C22H24N2O4S2 and a molecular weight of 444.58 g/mol. Its IUPAC name is 4-butoxy-N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]benzamide.
| Compound Name | 4-butoxy-N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]benzamide |
|---|---|
| PubChem CID | 41126037 |
| Molecular Formula | C22H24N2O4S2 |
| Molecular Weight | 444.58 g/mol |
| Exact Mass | 444.12 |
| IUPAC Name | 4-butoxy-N-[7-(2-methylsulfanylethyl)-[1,3]dioxolo[4,5-f][1,3]benzothiazol-6-ylidene]benzamide |
| SMILES | CCCCOc1ccc(C(=O)/N=c2\sc3cc4c(cc3n2CCSC)OCO4)cc1 |
| InChI | InChI=1S/C22H24N2O4S2/c1-3-4-10-26-16-7-5-15(6-8-16)21(25)23-22-24(9-11-29-2)17-12-18-19(28-14-27-18)13-20(17)30-22/h5-8,12-13H,3-4,9-11,14H2,1-2H3/b23-22- |
| InChIKey | DIDAZFITYWJHPT-FCQUAONHSA-N |
| XLogP | 4.71 |
| TPSA | 62.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.58 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|