C25H30N2O4S2 — CID 30680478
ethyl 3-(2-methylsulfanylethyl)-2-(4-pentoxybenzoyl)imino-1,3-benzothiazole-6-carboxylate (PubChem CID 30680478) has the molecular formula C25H30N2O4S2 and a molecular weight of 486.66 g/mol. Its IUPAC name is ethyl 3-(2-methylsulfanylethyl)-2-(4-pentoxybenzoyl)imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 3-(2-methylsulfanylethyl)-2-(4-pentoxybenzoyl)imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 30680478 |
| Molecular Formula | C25H30N2O4S2 |
| Molecular Weight | 486.66 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | ethyl 3-(2-methylsulfanylethyl)-2-(4-pentoxybenzoyl)imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCCOc1ccc(C(=O)/N=c2\sc3cc(C(=O)OCC)ccc3n2CCSC)cc1 |
| InChI | InChI=1S/C25H30N2O4S2/c1-4-6-7-15-31-20-11-8-18(9-12-20)23(28)26-25-27(14-16-32-3)21-13-10-19(17-22(21)33-25)24(29)30-5-2/h8-13,17H,4-7,14-16H2,1-3H3/b26-25- |
| InChIKey | VGSMMJDGHLOZJQ-QPLCGJKRSA-N |
| XLogP | 5.55 |
| TPSA | 69.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.66 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|