C26H30N2O6S — CID 4188815
ethyl 3-(2-ethoxy-2-oxoethyl)-2-(4-pentoxybenzoyl)imino-1,3-benzothiazole-6-carboxylate (PubChem CID 4188815) has the molecular formula C26H30N2O6S and a molecular weight of 498.60 g/mol. Its IUPAC name is ethyl 3-(2-ethoxy-2-oxoethyl)-2-(4-pentoxybenzoyl)imino-1,3-benzothiazole-6-carboxylate.
| Compound Name | ethyl 3-(2-ethoxy-2-oxoethyl)-2-(4-pentoxybenzoyl)imino-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 4188815 |
| Molecular Formula | C26H30N2O6S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.18 |
| IUPAC Name | ethyl 3-(2-ethoxy-2-oxoethyl)-2-(4-pentoxybenzoyl)imino-1,3-benzothiazole-6-carboxylate |
| SMILES | CCCCCOc1ccc(C(=O)/N=c2\sc3cc(C(=O)OCC)ccc3n2CC(=O)OCC)cc1 |
| InChI | InChI=1S/C26H30N2O6S/c1-4-7-8-15-34-20-12-9-18(10-13-20)24(30)27-26-28(17-23(29)32-5-2)21-14-11-19(16-22(21)35-26)25(31)33-6-3/h9-14,16H,4-8,15,17H2,1-3H3/b27-26- |
| InChIKey | FAQDRPZMDLZSOI-RQZHXJHFSA-N |
| XLogP | 4.75 |
| TPSA | 96.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|