C21H24N2O2S — CID 3267822
N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)-4-pentoxybenzamide (PubChem CID 3267822) has the molecular formula C21H24N2O2S and a molecular weight of 368.50 g/mol. Its IUPAC name is N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)-4-pentoxybenzamide.
| Compound Name | N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)-4-pentoxybenzamide |
|---|---|
| PubChem CID | 3267822 |
| Molecular Formula | C21H24N2O2S |
| Molecular Weight | 368.50 g/mol |
| Exact Mass | 368.16 |
| IUPAC Name | N-(3,6-dimethyl-1,3-benzothiazol-2-ylidene)-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)/N=c2\sc3cc(C)ccc3n2C)cc1 |
| InChI | InChI=1S/C21H24N2O2S/c1-4-5-6-13-25-17-10-8-16(9-11-17)20(24)22-21-23(3)18-12-7-15(2)14-19(18)26-21/h7-12,14H,4-6,13H2,1-3H3/b22-21- |
| InChIKey | STSIRKIKFANHGQ-DQRAZIAOSA-N |
| XLogP | 4.86 |
| TPSA | 43.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.50 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|