C22H25ClN2O3S — CID 3392087
N-[6-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide (PubChem CID 3392087) has the molecular formula C22H25ClN2O3S and a molecular weight of 432.97 g/mol. Its IUPAC name is N-[6-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide.
| Compound Name | N-[6-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide |
|---|---|
| PubChem CID | 3392087 |
| Molecular Formula | C22H25ClN2O3S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | N-[6-chloro-3-(2-methoxyethyl)-1,3-benzothiazol-2-ylidene]-4-pentoxybenzamide |
| SMILES | CCCCCOc1ccc(C(=O)/N=c2\sc3cc(Cl)ccc3n2CCOC)cc1 |
| InChI | InChI=1S/C22H25ClN2O3S/c1-3-4-5-13-28-18-9-6-16(7-10-18)21(26)24-22-25(12-14-27-2)19-11-8-17(23)15-20(19)29-22/h6-11,15H,3-5,12-14H2,1-2H3/b24-22- |
| InChIKey | GVQWVFVMUAMVJA-GYHWCHFESA-N |
| XLogP | 5.31 |
| TPSA | 52.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|